C9H13ClN4O5 — CID 141088158
[(2R)-3-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxy-2-methylpropyl]-methylcarbamic acid (PubChem CID 141088158) has the molecular formula C9H13ClN4O5 and a molecular weight of 292.68 g/mol. Its IUPAC name is [(2R)-3-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxy-2-methylpropyl]-methylcarbamic acid.
| Compound Name | [(2R)-3-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxy-2-methylpropyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 141088158 |
| Molecular Formula | C9H13ClN4O5 |
| Molecular Weight | 292.68 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | [(2R)-3-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxy-2-methylpropyl]-methylcarbamic acid |
| SMILES | CN(C[C@@](C)(O)Cn1cc([N+](=O)[O-])nc1Cl)C(=O)O |
| InChI | InChI=1S/C9H13ClN4O5/c1-9(17,4-12(2)8(15)16)5-13-3-6(14(18)19)11-7(13)10/h3,17H,4-5H2,1-2H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | HIRRRWBSHWCSFB-SECBINFHSA-N |
| XLogP | 0.81 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.68 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|