C8H12BrN3O6S — CID 129102678
[3-(2-bromo-4-nitroimidazol-1-yl)-2-hydroxy-2-methylpropyl] methanesulfonate (PubChem CID 129102678) has the molecular formula C8H12BrN3O6S and a molecular weight of 358.17 g/mol. Its IUPAC name is [3-(2-bromo-4-nitroimidazol-1-yl)-2-hydroxy-2-methylpropyl] methanesulfonate.
| Compound Name | [3-(2-bromo-4-nitroimidazol-1-yl)-2-hydroxy-2-methylpropyl] methanesulfonate |
|---|---|
| PubChem CID | 129102678 |
| Molecular Formula | C8H12BrN3O6S |
| Molecular Weight | 358.17 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | [3-(2-bromo-4-nitroimidazol-1-yl)-2-hydroxy-2-methylpropyl] methanesulfonate |
| SMILES | CC(O)(COS(C)(=O)=O)Cn1cc([N+](=O)[O-])nc1Br |
| InChI | InChI=1S/C8H12BrN3O6S/c1-8(13,5-18-19(2,16)17)4-11-3-6(12(14)15)10-7(11)9/h3,13H,4-5H2,1-2H3 |
| InChIKey | UKUUPMOVBHHKHL-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.17 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|