C11H6BrCl2N3O3 — CID 71618794
2-(2-bromo-4-nitroimidazol-1-yl)-1-(2,4-dichlorophenyl)ethanone (PubChem CID 71618794) has the molecular formula C11H6BrCl2N3O3 and a molecular weight of 379.00 g/mol. Its IUPAC name is 2-(2-bromo-4-nitroimidazol-1-yl)-1-(2,4-dichlorophenyl)ethanone.
| Compound Name | 2-(2-bromo-4-nitroimidazol-1-yl)-1-(2,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 71618794 |
| Molecular Formula | C11H6BrCl2N3O3 |
| Molecular Weight | 379.00 g/mol |
| Exact Mass | 376.90 |
| IUPAC Name | 2-(2-bromo-4-nitroimidazol-1-yl)-1-(2,4-dichlorophenyl)ethanone |
| SMILES | O=C(Cn1cc([N+](=O)[O-])nc1Br)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H6BrCl2N3O3/c12-11-15-10(17(19)20)5-16(11)4-9(18)7-2-1-6(13)3-8(7)14/h1-3,5H,4H2 |
| InChIKey | ASPDXPDAPFNSMF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.00 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|