C12H9Cl2N3O4 — CID 142707361
1-(2,4-dichlorophenyl)-2-(2-methoxy-4-nitroimidazol-1-yl)ethanone (PubChem CID 142707361) has the molecular formula C12H9Cl2N3O4 and a molecular weight of 330.13 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-(2-methoxy-4-nitroimidazol-1-yl)ethanone.
| Compound Name | 1-(2,4-dichlorophenyl)-2-(2-methoxy-4-nitroimidazol-1-yl)ethanone |
|---|---|
| PubChem CID | 142707361 |
| Molecular Formula | C12H9Cl2N3O4 |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-(2-methoxy-4-nitroimidazol-1-yl)ethanone |
| SMILES | COc1nc([N+](=O)[O-])cn1CC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H9Cl2N3O4/c1-21-12-15-11(17(19)20)6-16(12)5-10(18)8-3-2-7(13)4-9(8)14/h2-4,6H,5H2,1H3 |
| InChIKey | FJDVZHMQISWLDF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|