C19H22Cl2N4O5 — CID 142713558
[1-(2,4-dichlorophenyl)-2-(2-methoxy-4-nitroimidazol-1-yl)ethyl] N-cyclohexylcarbamate (PubChem CID 142713558) has the molecular formula C19H22Cl2N4O5 and a molecular weight of 457.31 g/mol. Its IUPAC name is [1-(2,4-dichlorophenyl)-2-(2-methoxy-4-nitroimidazol-1-yl)ethyl] N-cyclohexylcarbamate.
| Compound Name | [1-(2,4-dichlorophenyl)-2-(2-methoxy-4-nitroimidazol-1-yl)ethyl] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 142713558 |
| Molecular Formula | C19H22Cl2N4O5 |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | [1-(2,4-dichlorophenyl)-2-(2-methoxy-4-nitroimidazol-1-yl)ethyl] N-cyclohexylcarbamate |
| SMILES | COc1nc([N+](=O)[O-])cn1CC(OC(=O)NC1CCCCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H22Cl2N4O5/c1-29-18-23-17(25(27)28)11-24(18)10-16(14-8-7-12(20)9-15(14)21)30-19(26)22-13-5-3-2-4-6-13/h7-9,11,13,16H,2-6,10H2,1H3,(H,22,26) |
| InChIKey | WFJLSDFLJQNRDF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|