C27H26N2O4 — CID 102252212
[9H-fluoren-9-yl-(2-nitrophenyl)methyl] N-cyclohexylcarbamate (PubChem CID 102252212) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is [9H-fluoren-9-yl-(2-nitrophenyl)methyl] N-cyclohexylcarbamate.
| Compound Name | [9H-fluoren-9-yl-(2-nitrophenyl)methyl] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 102252212 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | [9H-fluoren-9-yl-(2-nitrophenyl)methyl] N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)OC(c1ccccc1[N+](=O)[O-])C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H26N2O4/c30-27(28-18-10-2-1-3-11-18)33-26(23-16-8-9-17-24(23)29(31)32)25-21-14-6-4-12-19(21)20-13-5-7-15-22(20)25/h4-9,12-18,25-26H,1-3,10-11H2,(H,28,30) |
| InChIKey | UHYKFHBGEHCYQZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|