About [[2-(2,4-dinitrophenyl)cyclohexylidene]amino] N-cyclohexylcarbamate
[[2-(2,4-dinitrophenyl)cyclohexylidene]amino] N-cyclohexylcarbamate (PubChem CID 3635551) has the molecular formula C19H24N4O6
and a molecular weight of 404.42 g/mol. Its IUPAC name is [[2-(2,4-dinitrophenyl)cyclohexylidene]amino] N-cyclohexylcarbamate.
Molecular Properties
| Compound Name | [[2-(2,4-dinitrophenyl)cyclohexylidene]amino] N-cyclohexylcarbamate |
| PubChem CID | 3635551 |
| Molecular Formula | C19H24N4O6 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [[2-(2,4-dinitrophenyl)cyclohexylidene]amino] N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)ON=C1CCCCC1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H24N4O6/c24-19(20-13-6-2-1-3-7-13)29-21-17-9-5-4-8-15(17)16-11-10-14(22(25)26)12-18(16)23(27)28/h10-13,15H,1-9H2,(H,20,24) |
| InChIKey | SJHVBDMCCFOAPF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[2-(2,4-dinitrophenyl)cyclohexylidene]amino] N-cyclohexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2-(2,4-dinitrophenyl)cyclohexylidene]amino] N-cyclohexylcarbamate?
The IUPAC name of [[2-(2,4-dinitrophenyl)cyclohexylidene]amino] N-cyclohexylcarbamate (CID 3635551) is [[2-(2,4-dinitrophenyl)cyclohexylidene]amino] N-cyclohexylcarbamate.
What is the SMILES notation for [[2-(2,4-dinitrophenyl)cyclohexylidene]amino] N-cyclohexylcarbamate?
The canonical SMILES for [[2-(2,4-dinitrophenyl)cyclohexylidene]amino] N-cyclohexylcarbamate is O=C(NC1CCCCC1)ON=C1CCCCC1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of [[2-(2,4-dinitrophenyl)cyclohexylidene]amino] N-cyclohexylcarbamate?
The InChIKey is SJHVBDMCCFOAPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N4O6/c24-19(20-13-6-2-1-3-7-13)29-21-17-9-5-4-8-15(17)16-11-10-14(22(25)26)12-18(16)23(27)28/h10-13,15H,1-9H2,(H,20,24).
What are the key properties of [[2-(2,4-dinitrophenyl)cyclohexylidene]amino] N-cyclohexylcarbamate?
[[2-(2,4-dinitrophenyl)cyclohexylidene]amino] N-cyclohexylcarbamate has a molecular weight of 404.42 g/mol, XLogP of 4.58, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [[2-(2,4-dinitrophenyl)cyclohexylidene]amino] N-cyclohexylcarbamate is sourced from PubChem (CID 3635551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).