C19H19N3O8S — CID 3800724
[[2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-methoxybenzenesulfonate (PubChem CID 3800724) has the molecular formula C19H19N3O8S and a molecular weight of 449.44 g/mol. Its IUPAC name is [[2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-methoxybenzenesulfonate.
| Compound Name | [[2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 3800724 |
| Molecular Formula | C19H19N3O8S |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | [[2-(2,4-dinitrophenyl)cyclohexylidene]amino] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)ON=C2CCCCC2c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19N3O8S/c1-29-14-7-9-15(10-8-14)31(27,28)30-20-18-5-3-2-4-16(18)17-11-6-13(21(23)24)12-19(17)22(25)26/h6-12,16H,2-5H2,1H3 |
| InChIKey | URMANQHESLCSOL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 151.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|