C20H16N2O10S2 — CID 15808495
1,2-bis[(4-methoxyphenyl)sulfonyl]-3,5-dinitrobenzene (PubChem CID 15808495) has the molecular formula C20H16N2O10S2 and a molecular weight of 508.49 g/mol. Its IUPAC name is 1,2-bis[(4-methoxyphenyl)sulfonyl]-3,5-dinitrobenzene.
| Compound Name | 1,2-bis[(4-methoxyphenyl)sulfonyl]-3,5-dinitrobenzene |
|---|---|
| PubChem CID | 15808495 |
| Molecular Formula | C20H16N2O10S2 |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | 1,2-bis[(4-methoxyphenyl)sulfonyl]-3,5-dinitrobenzene |
| SMILES | COc1ccc(S(=O)(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2S(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H16N2O10S2/c1-31-14-3-7-16(8-4-14)33(27,28)19-12-13(21(23)24)11-18(22(25)26)20(19)34(29,30)17-9-5-15(32-2)6-10-17/h3-12H,1-2H3 |
| InChIKey | TWTNODSENBEMLS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 173.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|