C21H12N4O9 — CID 2775527
9-[(4-methoxyphenyl)methylidene]-2,4,5,7-tetranitrofluorene (PubChem CID 2775527) has the molecular formula C21H12N4O9 and a molecular weight of 464.35 g/mol. Its IUPAC name is 9-[(4-methoxyphenyl)methylidene]-2,4,5,7-tetranitrofluorene.
| Compound Name | 9-[(4-methoxyphenyl)methylidene]-2,4,5,7-tetranitrofluorene |
|---|---|
| PubChem CID | 2775527 |
| Molecular Formula | C21H12N4O9 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 9-[(4-methoxyphenyl)methylidene]-2,4,5,7-tetranitrofluorene |
| SMILES | COc1ccc(C=C2c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3-c3c2cc([N+](=O)[O-])cc3[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H12N4O9/c1-34-14-4-2-11(3-5-14)6-15-16-7-12(22(26)27)9-18(24(30)31)20(16)21-17(15)8-13(23(28)29)10-19(21)25(32)33/h2-10H,1H3 |
| InChIKey | MXXSUVHJNGTHQX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 181.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|