C21H9N3O10 — CID 101368303
(4-formylphenyl) 2,5,7-trinitro-9-oxofluorene-4-carboxylate (PubChem CID 101368303) has the molecular formula C21H9N3O10 and a molecular weight of 463.31 g/mol. Its IUPAC name is (4-formylphenyl) 2,5,7-trinitro-9-oxofluorene-4-carboxylate.
| Compound Name | (4-formylphenyl) 2,5,7-trinitro-9-oxofluorene-4-carboxylate |
|---|---|
| PubChem CID | 101368303 |
| Molecular Formula | C21H9N3O10 |
| Molecular Weight | 463.31 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | (4-formylphenyl) 2,5,7-trinitro-9-oxofluorene-4-carboxylate |
| SMILES | O=Cc1ccc(OC(=O)c2cc([N+](=O)[O-])cc3c2-c2c(cc([N+](=O)[O-])cc2[N+](=O)[O-])C3=O)cc1 |
| InChI | InChI=1S/C21H9N3O10/c25-9-10-1-3-13(4-2-10)34-21(27)16-7-11(22(28)29)5-14-18(16)19-15(20(14)26)6-12(23(30)31)8-17(19)24(32)33/h1-9H |
| InChIKey | NEMAGCYWPNUSIG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 189.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|