C24H13N3O8S2 — CID 6050404
methyl (9E)-2,5,7-trinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carboxylate (PubChem CID 6050404) has the molecular formula C24H13N3O8S2 and a molecular weight of 535.52 g/mol. Its IUPAC name is methyl (9E)-2,5,7-trinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carboxylate.
| Compound Name | methyl (9E)-2,5,7-trinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carboxylate |
|---|---|
| PubChem CID | 6050404 |
| Molecular Formula | C24H13N3O8S2 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.01 |
| IUPAC Name | methyl (9E)-2,5,7-trinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carboxylate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])cc2c1-c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])/C2=C1\C=C(c2ccccc2)SS1 |
| InChI | InChI=1S/C24H13N3O8S2/c1-35-24(28)17-9-13(25(29)30)7-15-21(20-11-19(36-37-20)12-5-3-2-4-6-12)16-8-14(26(31)32)10-18(27(33)34)23(16)22(15)17/h2-11H,1H3/b21-20+ |
| InChIKey | XOYGDRLMLXVKAE-QZQOTICOSA-N |
| XLogP | 6.37 |
| TPSA | 155.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|