About (9Z)-2,7-dinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carbonitrile
(9Z)-2,7-dinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carbonitrile (PubChem CID 10647505) has the molecular formula C23H11N3O4S2
and a molecular weight of 457.49 g/mol. Its IUPAC name is (9Z)-2,7-dinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carbonitrile.
Molecular Properties
| Compound Name | (9Z)-2,7-dinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carbonitrile |
| PubChem CID | 10647505 |
| Molecular Formula | C23H11N3O4S2 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | (9Z)-2,7-dinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carbonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])cc2c1-c1ccc([N+](=O)[O-])cc1/C2=C1\C=C(c2ccccc2)SS1 |
| InChI | InChI=1S/C23H11N3O4S2/c24-12-14-8-16(26(29)30)10-19-22(14)17-7-6-15(25(27)28)9-18(17)23(19)21-11-20(31-32-21)13-4-2-1-3-5-13/h1-11H/b23-21- |
| InChIKey | BPUKIGAQGMWASE-LNVKXUELSA-N |
| XLogP | 6.55 |
| TPSA | 110.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (9Z)-2,7-dinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9Z)-2,7-dinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carbonitrile?
The IUPAC name of (9Z)-2,7-dinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carbonitrile (CID 10647505) is (9Z)-2,7-dinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carbonitrile.
What is the SMILES notation for (9Z)-2,7-dinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carbonitrile?
The canonical SMILES for (9Z)-2,7-dinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carbonitrile is N#Cc1cc([N+](=O)[O-])cc2c1-c1ccc([N+](=O)[O-])cc1/C2=C1\C=C(c2ccccc2)SS1.
What is the InChIKey of (9Z)-2,7-dinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carbonitrile?
The InChIKey is BPUKIGAQGMWASE-LNVKXUELSA-N. The full InChI is InChI=1S/C23H11N3O4S2/c24-12-14-8-16(26(29)30)10-19-22(14)17-7-6-15(25(27)28)9-18(17)23(19)21-11-20(31-32-21)13-4-2-1-3-5-13/h1-11H/b23-21-.
What are the key properties of (9Z)-2,7-dinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carbonitrile?
(9Z)-2,7-dinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carbonitrile has a molecular weight of 457.49 g/mol, XLogP of 6.55, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (9Z)-2,7-dinitro-9-(5-phenyldithiol-3-ylidene)fluorene-4-carbonitrile is sourced from PubChem (CID 10647505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).