C18H14N4O8 — CID 2775574
N,N-diethyl-2,5,7-trinitro-9-oxofluorene-4-carboxamide (PubChem CID 2775574) has the molecular formula C18H14N4O8 and a molecular weight of 414.33 g/mol. Its IUPAC name is N,N-diethyl-2,5,7-trinitro-9-oxofluorene-4-carboxamide.
| Compound Name | N,N-diethyl-2,5,7-trinitro-9-oxofluorene-4-carboxamide |
|---|---|
| PubChem CID | 2775574 |
| Molecular Formula | C18H14N4O8 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | N,N-diethyl-2,5,7-trinitro-9-oxofluorene-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc([N+](=O)[O-])cc2c1-c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])C2=O |
| InChI | InChI=1S/C18H14N4O8/c1-3-19(4-2)18(24)13-7-9(20(25)26)5-11-15(13)16-12(17(11)23)6-10(21(27)28)8-14(16)22(29)30/h5-8H,3-4H2,1-2H3 |
| InChIKey | CAWMIAGOJJQOFU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 166.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|