C15H20Cl2N4O6 — CID 87578459
2-[bis(2-chloroethyl)amino]-N-ethyl-N-(2-hydroxyethyl)-3,5-dinitrobenzamide (PubChem CID 87578459) has the molecular formula C15H20Cl2N4O6 and a molecular weight of 423.25 g/mol. Its IUPAC name is 2-[bis(2-chloroethyl)amino]-N-ethyl-N-(2-hydroxyethyl)-3,5-dinitrobenzamide.
| Compound Name | 2-[bis(2-chloroethyl)amino]-N-ethyl-N-(2-hydroxyethyl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 87578459 |
| Molecular Formula | C15H20Cl2N4O6 |
| Molecular Weight | 423.25 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 2-[bis(2-chloroethyl)amino]-N-ethyl-N-(2-hydroxyethyl)-3,5-dinitrobenzamide |
| SMILES | CCN(CCO)C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1N(CCCl)CCCl |
| InChI | InChI=1S/C15H20Cl2N4O6/c1-2-18(7-8-22)15(23)12-9-11(20(24)25)10-13(21(26)27)14(12)19(5-3-16)6-4-17/h9-10,22H,2-8H2,1H3 |
| InChIKey | AARKEARLGYXKLM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 130.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|