C12H15ClN4O8S — CID 10454256
2-[2-carbamoyl-N-(2-chloroethyl)-4,6-dinitroanilino]ethyl methanesulfonate (PubChem CID 10454256) has the molecular formula C12H15ClN4O8S and a molecular weight of 410.79 g/mol. Its IUPAC name is 2-[2-carbamoyl-N-(2-chloroethyl)-4,6-dinitroanilino]ethyl methanesulfonate.
| Compound Name | 2-[2-carbamoyl-N-(2-chloroethyl)-4,6-dinitroanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 10454256 |
| Molecular Formula | C12H15ClN4O8S |
| Molecular Weight | 410.79 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 2-[2-carbamoyl-N-(2-chloroethyl)-4,6-dinitroanilino]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCN(CCCl)c1c(C(N)=O)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15ClN4O8S/c1-26(23,24)25-5-4-15(3-2-13)11-9(12(14)18)6-8(16(19)20)7-10(11)17(21)22/h6-7H,2-5H2,1H3,(H2,14,18) |
| InChIKey | BLCMUMHBRDDXAM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 175.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.79 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|