C16H24N4O12S2 — CID 86610319
2-[2-(3-hydroxypropylcarbamoyl)-N-(2-methylsulfonyloxyethyl)-4,6-dinitroanilino]ethyl methanesulfonate (PubChem CID 86610319) has the molecular formula C16H24N4O12S2 and a molecular weight of 528.52 g/mol. Its IUPAC name is 2-[2-(3-hydroxypropylcarbamoyl)-N-(2-methylsulfonyloxyethyl)-4,6-dinitroanilino]ethyl methanesulfonate.
| Compound Name | 2-[2-(3-hydroxypropylcarbamoyl)-N-(2-methylsulfonyloxyethyl)-4,6-dinitroanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 86610319 |
| Molecular Formula | C16H24N4O12S2 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | 2-[2-(3-hydroxypropylcarbamoyl)-N-(2-methylsulfonyloxyethyl)-4,6-dinitroanilino]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCN(CCOS(C)(=O)=O)c1c(C(=O)NCCCO)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H24N4O12S2/c1-33(27,28)31-8-5-18(6-9-32-34(2,29)30)15-13(16(22)17-4-3-7-21)10-12(19(23)24)11-14(15)20(25)26/h10-11,21H,3-9H2,1-2H3,(H,17,22) |
| InChIKey | CQVDLUKWMKQQFK-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 225.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|