C15H21BrN4O9S — CID 11179819
2-[N-(2-bromoethyl)-2-(3-hydroxypropylcarbamoyl)-4,6-dinitroanilino]ethyl methanesulfonate (PubChem CID 11179819) has the molecular formula C15H21BrN4O9S and a molecular weight of 513.32 g/mol. Its IUPAC name is 2-[N-(2-bromoethyl)-2-(3-hydroxypropylcarbamoyl)-4,6-dinitroanilino]ethyl methanesulfonate.
| Compound Name | 2-[N-(2-bromoethyl)-2-(3-hydroxypropylcarbamoyl)-4,6-dinitroanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 11179819 |
| Molecular Formula | C15H21BrN4O9S |
| Molecular Weight | 513.32 g/mol |
| Exact Mass | 512.02 |
| IUPAC Name | 2-[N-(2-bromoethyl)-2-(3-hydroxypropylcarbamoyl)-4,6-dinitroanilino]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCN(CCBr)c1c(C(=O)NCCCO)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21BrN4O9S/c1-30(27,28)29-8-6-18(5-3-16)14-12(15(22)17-4-2-7-21)9-11(19(23)24)10-13(14)20(25)26/h9-10,21H,2-8H2,1H3,(H,17,22) |
| InChIKey | CMYVWQREHJIDSS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 182.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|