C17H26BrN4O12PS — CID 25056553
2-[N-(2-bromoethyl)-2,4-dinitro-6-(2-phosphonooxyethylcarbamoyl)anilino]ethyl butane-1-sulfonate (PubChem CID 25056553) has the molecular formula C17H26BrN4O12PS and a molecular weight of 621.36 g/mol. Its IUPAC name is 2-[N-(2-bromoethyl)-2,4-dinitro-6-(2-phosphonooxyethylcarbamoyl)anilino]ethyl butane-1-sulfonate.
| Compound Name | 2-[N-(2-bromoethyl)-2,4-dinitro-6-(2-phosphonooxyethylcarbamoyl)anilino]ethyl butane-1-sulfonate |
|---|---|
| PubChem CID | 25056553 |
| Molecular Formula | C17H26BrN4O12PS |
| Molecular Weight | 621.36 g/mol |
| Exact Mass | 620.02 |
| IUPAC Name | 2-[N-(2-bromoethyl)-2,4-dinitro-6-(2-phosphonooxyethylcarbamoyl)anilino]ethyl butane-1-sulfonate |
| SMILES | CCCCS(=O)(=O)OCCN(CCBr)c1c(C(=O)NCCOP(=O)(O)O)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H26BrN4O12PS/c1-2-3-10-36(31,32)34-9-7-20(6-4-18)16-14(17(23)19-5-8-33-35(28,29)30)11-13(21(24)25)12-15(16)22(26)27/h11-12H,2-10H2,1H3,(H,19,23)(H2,28,29,30) |
| InChIKey | YZELMQDLQCATML-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 228.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|