C15H21BrN3O12PS — CID 158022133
2-[N-(2-bromoethyl)-2,4-dinitro-6-(4-phosphonooxybutanoyl)anilino]ethyl methanesulfonate (PubChem CID 158022133) has the molecular formula C15H21BrN3O12PS and a molecular weight of 578.29 g/mol. Its IUPAC name is 2-[N-(2-bromoethyl)-2,4-dinitro-6-(4-phosphonooxybutanoyl)anilino]ethyl methanesulfonate.
| Compound Name | 2-[N-(2-bromoethyl)-2,4-dinitro-6-(4-phosphonooxybutanoyl)anilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 158022133 |
| Molecular Formula | C15H21BrN3O12PS |
| Molecular Weight | 578.29 g/mol |
| Exact Mass | 576.98 |
| IUPAC Name | 2-[N-(2-bromoethyl)-2,4-dinitro-6-(4-phosphonooxybutanoyl)anilino]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCN(CCBr)c1c(C(=O)CCCOP(=O)(O)O)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21BrN3O12PS/c1-33(28,29)31-8-6-17(5-4-16)15-12(14(20)3-2-7-30-32(25,26)27)9-11(18(21)22)10-13(15)19(23)24/h9-10H,2-8H2,1H3,(H2,25,26,27) |
| InChIKey | OLCUBPYJXXSUQJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 216.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|