C15H23BrN5O12PS — CID 11181008
2-[4-amino-N-(2-bromoethyl)-2,6-dinitro-3-(3-phosphonooxypropylcarbamoyl)anilino]ethyl methanesulfonate (PubChem CID 11181008) has the molecular formula C15H23BrN5O12PS and a molecular weight of 608.32 g/mol. Its IUPAC name is 2-[4-amino-N-(2-bromoethyl)-2,6-dinitro-3-(3-phosphonooxypropylcarbamoyl)anilino]ethyl methanesulfonate.
| Compound Name | 2-[4-amino-N-(2-bromoethyl)-2,6-dinitro-3-(3-phosphonooxypropylcarbamoyl)anilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 11181008 |
| Molecular Formula | C15H23BrN5O12PS |
| Molecular Weight | 608.32 g/mol |
| Exact Mass | 607.00 |
| IUPAC Name | 2-[4-amino-N-(2-bromoethyl)-2,6-dinitro-3-(3-phosphonooxypropylcarbamoyl)anilino]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCN(CCBr)c1c([N+](=O)[O-])cc(N)c(C(=O)NCCCOP(=O)(O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H23BrN5O12PS/c1-35(30,31)33-8-6-19(5-3-16)13-11(20(23)24)9-10(17)12(14(13)21(25)26)15(22)18-4-2-7-32-34(27,28)29/h9H,2-8,17H2,1H3,(H,18,22)(H2,27,28,29) |
| InChIKey | JSROOOBZVNGGQF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 254.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|