C21H33BrN4O9S2 — CID 90044563
2-[N-(2-bromoethyl)-2-ethylsulfonyl-5-(3-morpholin-4-ylpropylcarbamoyl)-4-nitroanilino]ethyl methanesulfonate (PubChem CID 90044563) has the molecular formula C21H33BrN4O9S2 and a molecular weight of 629.55 g/mol. Its IUPAC name is 2-[N-(2-bromoethyl)-2-ethylsulfonyl-5-(3-morpholin-4-ylpropylcarbamoyl)-4-nitroanilino]ethyl methanesulfonate.
| Compound Name | 2-[N-(2-bromoethyl)-2-ethylsulfonyl-5-(3-morpholin-4-ylpropylcarbamoyl)-4-nitroanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 90044563 |
| Molecular Formula | C21H33BrN4O9S2 |
| Molecular Weight | 629.55 g/mol |
| Exact Mass | 628.09 |
| IUPAC Name | 2-[N-(2-bromoethyl)-2-ethylsulfonyl-5-(3-morpholin-4-ylpropylcarbamoyl)-4-nitroanilino]ethyl methanesulfonate |
| SMILES | CCS(=O)(=O)c1cc([N+](=O)[O-])c(C(=O)NCCCN2CCOCC2)cc1N(CCBr)CCOS(C)(=O)=O |
| InChI | InChI=1S/C21H33BrN4O9S2/c1-3-37(32,33)20-16-18(26(28)29)17(21(27)23-6-4-7-24-9-12-34-13-10-24)15-19(20)25(8-5-22)11-14-35-36(2,30)31/h15-16H,3-14H2,1-2H3,(H,23,27) |
| InChIKey | AWGRZAGILICCRT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 165.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.55 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|