C22H32BrN5O6S — CID 118461006
2-[5-[3-(azepan-1-yl)propylcarbamoyl]-N-(2-bromoethyl)-2-cyano-4-nitroanilino]ethyl methanesulfonate (PubChem CID 118461006) has the molecular formula C22H32BrN5O6S and a molecular weight of 574.50 g/mol. Its IUPAC name is 2-[5-[3-(azepan-1-yl)propylcarbamoyl]-N-(2-bromoethyl)-2-cyano-4-nitroanilino]ethyl methanesulfonate.
| Compound Name | 2-[5-[3-(azepan-1-yl)propylcarbamoyl]-N-(2-bromoethyl)-2-cyano-4-nitroanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 118461006 |
| Molecular Formula | C22H32BrN5O6S |
| Molecular Weight | 574.50 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | 2-[5-[3-(azepan-1-yl)propylcarbamoyl]-N-(2-bromoethyl)-2-cyano-4-nitroanilino]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCN(CCBr)c1cc(C(=O)NCCCN2CCCCCC2)c([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C22H32BrN5O6S/c1-35(32,33)34-14-13-27(12-7-23)20-16-19(21(28(30)31)15-18(20)17-24)22(29)25-8-6-11-26-9-4-2-3-5-10-26/h15-16H,2-14H2,1H3,(H,25,29) |
| InChIKey | LGIZSCSWICZGCY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 145.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|