C12H14BrN3O5S — CID 141410795
2-[N-(2-bromoethyl)-2-cyano-4-nitroanilino]ethyl methanesulfonate (PubChem CID 141410795) has the molecular formula C12H14BrN3O5S and a molecular weight of 392.23 g/mol. Its IUPAC name is 2-[N-(2-bromoethyl)-2-cyano-4-nitroanilino]ethyl methanesulfonate.
| Compound Name | 2-[N-(2-bromoethyl)-2-cyano-4-nitroanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 141410795 |
| Molecular Formula | C12H14BrN3O5S |
| Molecular Weight | 392.23 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | 2-[N-(2-bromoethyl)-2-cyano-4-nitroanilino]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCN(CCBr)c1ccc([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C12H14BrN3O5S/c1-22(19,20)21-7-6-15(5-4-13)12-3-2-11(16(17)18)8-10(12)9-14/h2-3,8H,4-7H2,1H3 |
| InChIKey | XGRGWHUEKKWRCB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 113.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|