C15H23BrN4O7S2 — CID 139535304
2-[N-(2-bromoethyl)-4-nitro-2-piperazin-1-ylsulfonylanilino]ethyl methanesulfonate (PubChem CID 139535304) has the molecular formula C15H23BrN4O7S2 and a molecular weight of 515.41 g/mol. Its IUPAC name is 2-[N-(2-bromoethyl)-4-nitro-2-piperazin-1-ylsulfonylanilino]ethyl methanesulfonate.
| Compound Name | 2-[N-(2-bromoethyl)-4-nitro-2-piperazin-1-ylsulfonylanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 139535304 |
| Molecular Formula | C15H23BrN4O7S2 |
| Molecular Weight | 515.41 g/mol |
| Exact Mass | 514.02 |
| IUPAC Name | 2-[N-(2-bromoethyl)-4-nitro-2-piperazin-1-ylsulfonylanilino]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCN(CCBr)c1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C15H23BrN4O7S2/c1-28(23,24)27-11-10-18(7-4-16)14-3-2-13(20(21)22)12-15(14)29(25,26)19-8-5-17-6-9-19/h2-3,12,17H,4-11H2,1H3 |
| InChIKey | ULUZUUMZWVMIBN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.41 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|