C17H28N4O10S3 — CID 139535344
2-[N-(2-methylsulfonyloxyethyl)-4-nitro-2-(piperazin-1-ylmethylsulfonyl)anilino]ethyl methanesulfonate (PubChem CID 139535344) has the molecular formula C17H28N4O10S3 and a molecular weight of 544.63 g/mol. Its IUPAC name is 2-[N-(2-methylsulfonyloxyethyl)-4-nitro-2-(piperazin-1-ylmethylsulfonyl)anilino]ethyl methanesulfonate.
| Compound Name | 2-[N-(2-methylsulfonyloxyethyl)-4-nitro-2-(piperazin-1-ylmethylsulfonyl)anilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 139535344 |
| Molecular Formula | C17H28N4O10S3 |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | 2-[N-(2-methylsulfonyloxyethyl)-4-nitro-2-(piperazin-1-ylmethylsulfonyl)anilino]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCN(CCOS(C)(=O)=O)c1ccc([N+](=O)[O-])cc1S(=O)(=O)CN1CCNCC1 |
| InChI | InChI=1S/C17H28N4O10S3/c1-32(24,25)30-11-9-20(10-12-31-33(2,26)27)16-4-3-15(21(22)23)13-17(16)34(28,29)14-19-7-5-18-6-8-19/h3-4,13,18H,5-12,14H2,1-2H3 |
| InChIKey | IUNFNXJZSRGGSB-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 182.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|