C18H30N4O13S4 — CID 175071916
[4-[2-[bis(2-methylsulfonyloxyethyl)amino]-3-methyl-5-nitrophenyl]sulfonylpiperazin-1-yl]methanesulfonic acid (PubChem CID 175071916) has the molecular formula C18H30N4O13S4 and a molecular weight of 638.72 g/mol. Its IUPAC name is [4-[2-[bis(2-methylsulfonyloxyethyl)amino]-3-methyl-5-nitrophenyl]sulfonylpiperazin-1-yl]methanesulfonic acid.
| Compound Name | [4-[2-[bis(2-methylsulfonyloxyethyl)amino]-3-methyl-5-nitrophenyl]sulfonylpiperazin-1-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 175071916 |
| Molecular Formula | C18H30N4O13S4 |
| Molecular Weight | 638.72 g/mol |
| Exact Mass | 638.07 |
| IUPAC Name | [4-[2-[bis(2-methylsulfonyloxyethyl)amino]-3-methyl-5-nitrophenyl]sulfonylpiperazin-1-yl]methanesulfonic acid |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)N2CCN(CS(=O)(=O)O)CC2)c1N(CCOS(C)(=O)=O)CCOS(C)(=O)=O |
| InChI | InChI=1S/C18H30N4O13S4/c1-15-12-16(22(23)24)13-17(39(32,33)21-6-4-19(5-7-21)14-38(29,30)31)18(15)20(8-10-34-36(2,25)26)9-11-35-37(3,27)28/h12-13H,4-11,14H2,1-3H3,(H,29,30,31) |
| InChIKey | BCMGAIZDCAFEJI-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 228.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.72 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|