C18H28BrN5O9S2 — CID 139535393
2-[N-(2-bromoethyl)-2-[(5-methyl-1,5-diazocan-1-yl)sulfonyl]-4,6-dinitroanilino]ethyl methanesulfonate (PubChem CID 139535393) has the molecular formula C18H28BrN5O9S2 and a molecular weight of 602.49 g/mol. Its IUPAC name is 2-[N-(2-bromoethyl)-2-[(5-methyl-1,5-diazocan-1-yl)sulfonyl]-4,6-dinitroanilino]ethyl methanesulfonate.
| Compound Name | 2-[N-(2-bromoethyl)-2-[(5-methyl-1,5-diazocan-1-yl)sulfonyl]-4,6-dinitroanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 139535393 |
| Molecular Formula | C18H28BrN5O9S2 |
| Molecular Weight | 602.49 g/mol |
| Exact Mass | 601.05 |
| IUPAC Name | 2-[N-(2-bromoethyl)-2-[(5-methyl-1,5-diazocan-1-yl)sulfonyl]-4,6-dinitroanilino]ethyl methanesulfonate |
| SMILES | CN1CCCN(S(=O)(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2N(CCBr)CCOS(C)(=O)=O)CCC1 |
| InChI | InChI=1S/C18H28BrN5O9S2/c1-20-6-3-8-22(9-4-7-20)35(31,32)17-14-15(23(25)26)13-16(24(27)28)18(17)21(10-5-19)11-12-33-34(2,29)30/h13-14H,3-12H2,1-2H3 |
| InChIKey | AOYKYKXGBCKQLE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 173.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.49 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|