C22H28BrClN4O7S2 — CID 156676533
2-[N-(2-bromoethyl)-2-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-6-methyl-4-nitroanilino]ethyl methanesulfonate (PubChem CID 156676533) has the molecular formula C22H28BrClN4O7S2 and a molecular weight of 639.98 g/mol. Its IUPAC name is 2-[N-(2-bromoethyl)-2-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-6-methyl-4-nitroanilino]ethyl methanesulfonate.
| Compound Name | 2-[N-(2-bromoethyl)-2-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-6-methyl-4-nitroanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 156676533 |
| Molecular Formula | C22H28BrClN4O7S2 |
| Molecular Weight | 639.98 g/mol |
| Exact Mass | 638.03 |
| IUPAC Name | 2-[N-(2-bromoethyl)-2-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-6-methyl-4-nitroanilino]ethyl methanesulfonate |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)N2CCN(c3cccc(Cl)c3)CC2)c1N(CCBr)CCOS(C)(=O)=O |
| InChI | InChI=1S/C22H28BrClN4O7S2/c1-17-14-20(28(29)30)16-21(22(17)26(7-6-23)12-13-35-36(2,31)32)37(33,34)27-10-8-25(9-11-27)19-5-3-4-18(24)15-19/h3-5,14-16H,6-13H2,1-2H3 |
| InChIKey | PMZFMMVNAHIZSQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 130.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.98 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|