C22H27Br2ClN4O4S — CID 156676503
N,N-bis(2-bromoethyl)-2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]sulfonyl-6-methyl-4-nitroaniline (PubChem CID 156676503) has the molecular formula C22H27Br2ClN4O4S and a molecular weight of 638.81 g/mol. Its IUPAC name is N,N-bis(2-bromoethyl)-2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]sulfonyl-6-methyl-4-nitroaniline.
| Compound Name | N,N-bis(2-bromoethyl)-2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]sulfonyl-6-methyl-4-nitroaniline |
|---|---|
| PubChem CID | 156676503 |
| Molecular Formula | C22H27Br2ClN4O4S |
| Molecular Weight | 638.81 g/mol |
| Exact Mass | 635.98 |
| IUPAC Name | N,N-bis(2-bromoethyl)-2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]sulfonyl-6-methyl-4-nitroaniline |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)N2CCN(Cc3cccc(Cl)c3)CC2)c1N(CCBr)CCBr |
| InChI | InChI=1S/C22H27Br2ClN4O4S/c1-17-13-20(29(30)31)15-21(22(17)27(7-5-23)8-6-24)34(32,33)28-11-9-26(10-12-28)16-18-3-2-4-19(25)14-18/h2-4,13-15H,5-12,16H2,1H3 |
| InChIKey | ZGTSRIKTSRKXOB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|