C19H23ClN2O3S — CID 110399108
1-[(3-chlorophenyl)methyl]-4-(4-methoxy-2-methylphenyl)sulfonylpiperazine (PubChem CID 110399108) has the molecular formula C19H23ClN2O3S and a molecular weight of 394.92 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-4-(4-methoxy-2-methylphenyl)sulfonylpiperazine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-4-(4-methoxy-2-methylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 110399108 |
| Molecular Formula | C19H23ClN2O3S |
| Molecular Weight | 394.92 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-4-(4-methoxy-2-methylphenyl)sulfonylpiperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(Cc3cccc(Cl)c3)CC2)c(C)c1 |
| InChI | InChI=1S/C19H23ClN2O3S/c1-15-12-18(25-2)6-7-19(15)26(23,24)22-10-8-21(9-11-22)14-16-4-3-5-17(20)13-16/h3-7,12-13H,8-11,14H2,1-2H3 |
| InChIKey | RAEQQFNWHFJYKO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.92 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |