C17H18Cl2N2O2S — CID 9391386
1-[(3-chlorophenyl)methyl]-4-(2-chlorophenyl)sulfonylpiperazine (PubChem CID 9391386) has the molecular formula C17H18Cl2N2O2S and a molecular weight of 385.32 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-4-(2-chlorophenyl)sulfonylpiperazine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-4-(2-chlorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 9391386 |
| Molecular Formula | C17H18Cl2N2O2S |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-4-(2-chlorophenyl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccccc1Cl)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H18Cl2N2O2S/c18-15-5-3-4-14(12-15)13-20-8-10-21(11-9-20)24(22,23)17-7-2-1-6-16(17)19/h1-7,12H,8-11,13H2 |
| InChIKey | NZURVGNRJLBXCT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |