C15H22Br2N4O4S — CID 139535447
N,N-bis(2-bromoethyl)-2-methyl-4-nitro-6-piperazin-1-ylsulfonylaniline (PubChem CID 139535447) has the molecular formula C15H22Br2N4O4S and a molecular weight of 514.24 g/mol. Its IUPAC name is N,N-bis(2-bromoethyl)-2-methyl-4-nitro-6-piperazin-1-ylsulfonylaniline.
| Compound Name | N,N-bis(2-bromoethyl)-2-methyl-4-nitro-6-piperazin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 139535447 |
| Molecular Formula | C15H22Br2N4O4S |
| Molecular Weight | 514.24 g/mol |
| Exact Mass | 511.97 |
| IUPAC Name | N,N-bis(2-bromoethyl)-2-methyl-4-nitro-6-piperazin-1-ylsulfonylaniline |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)N2CCNCC2)c1N(CCBr)CCBr |
| InChI | InChI=1S/C15H22Br2N4O4S/c1-12-10-13(21(22)23)11-14(15(12)19(6-2-16)7-3-17)26(24,25)20-8-4-18-5-9-20/h10-11,18H,2-9H2,1H3 |
| InChIKey | UWNYUFDTHMHDMB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|