C18H27Br2N3O4S — CID 156676527
N,N-bis(2-bromoethyl)-2-methyl-6-(1-methylazepan-4-yl)sulfonyl-4-nitroaniline (PubChem CID 156676527) has the molecular formula C18H27Br2N3O4S and a molecular weight of 541.31 g/mol. Its IUPAC name is N,N-bis(2-bromoethyl)-2-methyl-6-(1-methylazepan-4-yl)sulfonyl-4-nitroaniline.
| Compound Name | N,N-bis(2-bromoethyl)-2-methyl-6-(1-methylazepan-4-yl)sulfonyl-4-nitroaniline |
|---|---|
| PubChem CID | 156676527 |
| Molecular Formula | C18H27Br2N3O4S |
| Molecular Weight | 541.31 g/mol |
| Exact Mass | 539.01 |
| IUPAC Name | N,N-bis(2-bromoethyl)-2-methyl-6-(1-methylazepan-4-yl)sulfonyl-4-nitroaniline |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)C2CCCN(C)CC2)c1N(CCBr)CCBr |
| InChI | InChI=1S/C18H27Br2N3O4S/c1-14-12-15(23(24)25)13-17(18(14)22(10-6-19)11-7-20)28(26,27)16-4-3-8-21(2)9-5-16/h12-13,16H,3-11H2,1-2H3 |
| InChIKey | AXEVKULBTGMBBU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|