C13H16BrClN2O6S — CID 122545097
2-[N-(2-bromoethyl)-2-carbonochloridoyl-6-methyl-4-nitroanilino]ethyl methanesulfonate (PubChem CID 122545097) has the molecular formula C13H16BrClN2O6S and a molecular weight of 443.70 g/mol. Its IUPAC name is 2-[N-(2-bromoethyl)-2-carbonochloridoyl-6-methyl-4-nitroanilino]ethyl methanesulfonate.
| Compound Name | 2-[N-(2-bromoethyl)-2-carbonochloridoyl-6-methyl-4-nitroanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 122545097 |
| Molecular Formula | C13H16BrClN2O6S |
| Molecular Weight | 443.70 g/mol |
| Exact Mass | 441.96 |
| IUPAC Name | 2-[N-(2-bromoethyl)-2-carbonochloridoyl-6-methyl-4-nitroanilino]ethyl methanesulfonate |
| SMILES | Cc1cc([N+](=O)[O-])cc(C(=O)Cl)c1N(CCBr)CCOS(C)(=O)=O |
| InChI | InChI=1S/C13H16BrClN2O6S/c1-9-7-10(17(19)20)8-11(13(15)18)12(9)16(4-3-14)5-6-23-24(2,21)22/h7-8H,3-6H2,1-2H3 |
| InChIKey | VDBUNMRTLICANO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.70 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|