C17H27BrN4O6S — CID 118460986
2-[N-(2-bromoethyl)-5-[2-(dimethylamino)ethylcarbamoyl]-2-methyl-4-nitroanilino]ethyl methanesulfonate (PubChem CID 118460986) has the molecular formula C17H27BrN4O6S and a molecular weight of 495.40 g/mol. Its IUPAC name is 2-[N-(2-bromoethyl)-5-[2-(dimethylamino)ethylcarbamoyl]-2-methyl-4-nitroanilino]ethyl methanesulfonate.
| Compound Name | 2-[N-(2-bromoethyl)-5-[2-(dimethylamino)ethylcarbamoyl]-2-methyl-4-nitroanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 118460986 |
| Molecular Formula | C17H27BrN4O6S |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 2-[N-(2-bromoethyl)-5-[2-(dimethylamino)ethylcarbamoyl]-2-methyl-4-nitroanilino]ethyl methanesulfonate |
| SMILES | Cc1cc([N+](=O)[O-])c(C(=O)NCCN(C)C)cc1N(CCBr)CCOS(C)(=O)=O |
| InChI | InChI=1S/C17H27BrN4O6S/c1-13-11-16(22(24)25)14(17(23)19-6-8-20(2)3)12-15(13)21(7-5-18)9-10-28-29(4,26)27/h11-12H,5-10H2,1-4H3,(H,19,23) |
| InChIKey | FXSIYEITCJJUCT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|