C17H21BrN4O8S — CID 90043753
3-[[5-[2-bromoethyl(2-methylsulfonyloxyethyl)amino]-4-cyano-2-nitrobenzoyl]-methylamino]propanoic acid (PubChem CID 90043753) has the molecular formula C17H21BrN4O8S and a molecular weight of 521.35 g/mol. Its IUPAC name is 3-[[5-[2-bromoethyl(2-methylsulfonyloxyethyl)amino]-4-cyano-2-nitrobenzoyl]-methylamino]propanoic acid.
| Compound Name | 3-[[5-[2-bromoethyl(2-methylsulfonyloxyethyl)amino]-4-cyano-2-nitrobenzoyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 90043753 |
| Molecular Formula | C17H21BrN4O8S |
| Molecular Weight | 521.35 g/mol |
| Exact Mass | 520.03 |
| IUPAC Name | 3-[[5-[2-bromoethyl(2-methylsulfonyloxyethyl)amino]-4-cyano-2-nitrobenzoyl]-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)c1cc(N(CCBr)CCOS(C)(=O)=O)c(C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21BrN4O8S/c1-20(5-3-16(23)24)17(25)13-10-14(12(11-19)9-15(13)22(26)27)21(6-4-18)7-8-30-31(2,28)29/h9-10H,3-8H2,1-2H3,(H,23,24) |
| InChIKey | ZEBMGNBYYRDRJY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 171.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|