C14H20N2O12S3 — CID 90043101
5-[bis(2-methylsulfonyloxyethyl)amino]-4-methylsulfonyl-2-nitrobenzoic acid (PubChem CID 90043101) has the molecular formula C14H20N2O12S3 and a molecular weight of 504.52 g/mol. Its IUPAC name is 5-[bis(2-methylsulfonyloxyethyl)amino]-4-methylsulfonyl-2-nitrobenzoic acid.
| Compound Name | 5-[bis(2-methylsulfonyloxyethyl)amino]-4-methylsulfonyl-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 90043101 |
| Molecular Formula | C14H20N2O12S3 |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | 5-[bis(2-methylsulfonyloxyethyl)amino]-4-methylsulfonyl-2-nitrobenzoic acid |
| SMILES | CS(=O)(=O)OCCN(CCOS(C)(=O)=O)c1cc(C(=O)O)c([N+](=O)[O-])cc1S(C)(=O)=O |
| InChI | InChI=1S/C14H20N2O12S3/c1-29(21,22)13-9-11(16(19)20)10(14(17)18)8-12(13)15(4-6-27-30(2,23)24)5-7-28-31(3,25)26/h8-9H,4-7H2,1-3H3,(H,17,18) |
| InChIKey | BGGAPVZCZKFLFC-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 204.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|