C17H27N3O12S3 — CID 90044182
2-[5-[2-hydroxyethyl(methyl)carbamoyl]-2-methylsulfonyl-N-(2-methylsulfonyloxyethyl)-4-nitroanilino]ethyl methanesulfonate (PubChem CID 90044182) has the molecular formula C17H27N3O12S3 and a molecular weight of 561.61 g/mol. Its IUPAC name is 2-[5-[2-hydroxyethyl(methyl)carbamoyl]-2-methylsulfonyl-N-(2-methylsulfonyloxyethyl)-4-nitroanilino]ethyl methanesulfonate.
| Compound Name | 2-[5-[2-hydroxyethyl(methyl)carbamoyl]-2-methylsulfonyl-N-(2-methylsulfonyloxyethyl)-4-nitroanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 90044182 |
| Molecular Formula | C17H27N3O12S3 |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.08 |
| IUPAC Name | 2-[5-[2-hydroxyethyl(methyl)carbamoyl]-2-methylsulfonyl-N-(2-methylsulfonyloxyethyl)-4-nitroanilino]ethyl methanesulfonate |
| SMILES | CN(CCO)C(=O)c1cc(N(CCOS(C)(=O)=O)CCOS(C)(=O)=O)c(S(C)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H27N3O12S3/c1-18(5-8-21)17(22)13-11-15(16(33(2,25)26)12-14(13)20(23)24)19(6-9-31-34(3,27)28)7-10-32-35(4,29)30/h11-12,21H,5-10H2,1-4H3 |
| InChIKey | DFQAYJRGWLBJIJ-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 207.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|