C19H30N4O11S3 — CID 90044291
3-[5-(4-methylpiperazine-1-carbonyl)-2-methylsulfonyl-4-nitro-N-(3-sulfopropyl)anilino]propane-1-sulfonic acid (PubChem CID 90044291) has the molecular formula C19H30N4O11S3 and a molecular weight of 586.67 g/mol. Its IUPAC name is 3-[5-(4-methylpiperazine-1-carbonyl)-2-methylsulfonyl-4-nitro-N-(3-sulfopropyl)anilino]propane-1-sulfonic acid.
| Compound Name | 3-[5-(4-methylpiperazine-1-carbonyl)-2-methylsulfonyl-4-nitro-N-(3-sulfopropyl)anilino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 90044291 |
| Molecular Formula | C19H30N4O11S3 |
| Molecular Weight | 586.67 g/mol |
| Exact Mass | 586.11 |
| IUPAC Name | 3-[5-(4-methylpiperazine-1-carbonyl)-2-methylsulfonyl-4-nitro-N-(3-sulfopropyl)anilino]propane-1-sulfonic acid |
| SMILES | CN1CCN(C(=O)c2cc(N(CCCS(=O)(=O)O)CCCS(=O)(=O)O)c(S(C)(=O)=O)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H30N4O11S3/c1-20-7-9-22(10-8-20)19(24)15-13-17(18(35(2,27)28)14-16(15)23(25)26)21(5-3-11-36(29,30)31)6-4-12-37(32,33)34/h13-14H,3-12H2,1-2H3,(H,29,30,31)(H,32,33,34) |
| InChIKey | CKSWWOFDLKVNCS-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 212.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.67 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|