C15H20BrN3O8S — CID 158022128
2-[N-(2-bromoethyl)-2-(4-hydroxybutanoyl)-6-nitro-4-nitrosoanilino]ethyl methanesulfonate (PubChem CID 158022128) has the molecular formula C15H20BrN3O8S and a molecular weight of 482.31 g/mol. Its IUPAC name is 2-[N-(2-bromoethyl)-2-(4-hydroxybutanoyl)-6-nitro-4-nitrosoanilino]ethyl methanesulfonate.
| Compound Name | 2-[N-(2-bromoethyl)-2-(4-hydroxybutanoyl)-6-nitro-4-nitrosoanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 158022128 |
| Molecular Formula | C15H20BrN3O8S |
| Molecular Weight | 482.31 g/mol |
| Exact Mass | 481.02 |
| IUPAC Name | 2-[N-(2-bromoethyl)-2-(4-hydroxybutanoyl)-6-nitro-4-nitrosoanilino]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCN(CCBr)c1c(C(=O)CCCO)cc(N=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20BrN3O8S/c1-28(25,26)27-8-6-18(5-4-16)15-12(14(21)3-2-7-20)9-11(17-22)10-13(15)19(23)24/h9-10,20H,2-8H2,1H3 |
| InChIKey | CSLPDKZWKSFOCI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 156.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|