C20H28Br2N4O7 — CID 58492718
10-[2-[bis(2-bromoethyl)amino]-3,5-dinitrophenyl]-N-hydroxy-10-oxodecanamide (PubChem CID 58492718) has the molecular formula C20H28Br2N4O7 and a molecular weight of 596.27 g/mol. Its IUPAC name is 10-[2-[bis(2-bromoethyl)amino]-3,5-dinitrophenyl]-N-hydroxy-10-oxodecanamide.
| Compound Name | 10-[2-[bis(2-bromoethyl)amino]-3,5-dinitrophenyl]-N-hydroxy-10-oxodecanamide |
|---|---|
| PubChem CID | 58492718 |
| Molecular Formula | C20H28Br2N4O7 |
| Molecular Weight | 596.27 g/mol |
| Exact Mass | 594.03 |
| IUPAC Name | 10-[2-[bis(2-bromoethyl)amino]-3,5-dinitrophenyl]-N-hydroxy-10-oxodecanamide |
| SMILES | O=C(CCCCCCCCC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1N(CCBr)CCBr)NO |
| InChI | InChI=1S/C20H28Br2N4O7/c21-9-11-24(12-10-22)20-16(13-15(25(30)31)14-17(20)26(32)33)18(27)7-5-3-1-2-4-6-8-19(28)23-29/h13-14,29H,1-12H2,(H,23,28) |
| InChIKey | JSLMGWZZNLLBHL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.27 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|