C13H16I2N4O6 — CID 11157455
N-[2-[bis(2-iodoethyl)amino]-3,5-dinitrophenyl]-3-hydroxypropanamide (PubChem CID 11157455) has the molecular formula C13H16I2N4O6 and a molecular weight of 578.10 g/mol. Its IUPAC name is N-[2-[bis(2-iodoethyl)amino]-3,5-dinitrophenyl]-3-hydroxypropanamide.
| Compound Name | N-[2-[bis(2-iodoethyl)amino]-3,5-dinitrophenyl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 11157455 |
| Molecular Formula | C13H16I2N4O6 |
| Molecular Weight | 578.10 g/mol |
| Exact Mass | 577.92 |
| IUPAC Name | N-[2-[bis(2-iodoethyl)amino]-3,5-dinitrophenyl]-3-hydroxypropanamide |
| SMILES | O=C(CCO)Nc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1N(CCI)CCI |
| InChI | InChI=1S/C13H16I2N4O6/c14-2-4-17(5-3-15)13-10(16-12(21)1-6-20)7-9(18(22)23)8-11(13)19(24)25/h7-8,20H,1-6H2,(H,16,21) |
| InChIKey | NNTKBKQLZFPRGT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.10 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|