C15H20ClN3O7 — CID 86641737
tert-butyl 2-[2-chloroethyl(2-hydroxyethyl)amino]-3,5-dinitrobenzoate (PubChem CID 86641737) has the molecular formula C15H20ClN3O7 and a molecular weight of 389.79 g/mol. Its IUPAC name is tert-butyl 2-[2-chloroethyl(2-hydroxyethyl)amino]-3,5-dinitrobenzoate.
| Compound Name | tert-butyl 2-[2-chloroethyl(2-hydroxyethyl)amino]-3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 86641737 |
| Molecular Formula | C15H20ClN3O7 |
| Molecular Weight | 389.79 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | tert-butyl 2-[2-chloroethyl(2-hydroxyethyl)amino]-3,5-dinitrobenzoate |
| SMILES | CC(C)(C)OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1N(CCO)CCCl |
| InChI | InChI=1S/C15H20ClN3O7/c1-15(2,3)26-14(21)11-8-10(18(22)23)9-12(19(24)25)13(11)17(5-4-16)6-7-20/h8-9,20H,4-7H2,1-3H3 |
| InChIKey | HOCSWSULHLYSOH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.79 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|