C14H18Br2N4O6 — CID 11397874
2-[bis(2-bromoethyl)amino]-N-(3-hydroxypropyl)-3,5-dinitrobenzamide (PubChem CID 11397874) has the molecular formula C14H18Br2N4O6 and a molecular weight of 498.13 g/mol. Its IUPAC name is 2-[bis(2-bromoethyl)amino]-N-(3-hydroxypropyl)-3,5-dinitrobenzamide.
| Compound Name | 2-[bis(2-bromoethyl)amino]-N-(3-hydroxypropyl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 11397874 |
| Molecular Formula | C14H18Br2N4O6 |
| Molecular Weight | 498.13 g/mol |
| Exact Mass | 495.96 |
| IUPAC Name | 2-[bis(2-bromoethyl)amino]-N-(3-hydroxypropyl)-3,5-dinitrobenzamide |
| SMILES | O=C(NCCCO)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1N(CCBr)CCBr |
| InChI | InChI=1S/C14H18Br2N4O6/c15-2-5-18(6-3-16)13-11(14(22)17-4-1-7-21)8-10(19(23)24)9-12(13)20(25)26/h8-9,21H,1-7H2,(H,17,22) |
| InChIKey | KAMGTSLQSBBUOX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.13 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|