C11H14ClN3O6 — CID 143639792
2-chloro-N-(2-hydroxyethyl)-3,5-dinitrobenzamide;ethane (PubChem CID 143639792) has the molecular formula C11H14ClN3O6 and a molecular weight of 319.70 g/mol. Its IUPAC name is 2-chloro-N-(2-hydroxyethyl)-3,5-dinitrobenzamide;ethane.
| Compound Name | 2-chloro-N-(2-hydroxyethyl)-3,5-dinitrobenzamide;ethane |
|---|---|
| PubChem CID | 143639792 |
| Molecular Formula | C11H14ClN3O6 |
| Molecular Weight | 319.70 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-chloro-N-(2-hydroxyethyl)-3,5-dinitrobenzamide;ethane |
| SMILES | CC.O=C(NCCO)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C9H8ClN3O6.C2H6/c10-8-6(9(15)11-1-2-14)3-5(12(16)17)4-7(8)13(18)19;1-2/h3-4,14H,1-2H2,(H,11,15);1-2H3 |
| InChIKey | ACVRWMHHQHLJHT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.70 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|