C9H8BN3O6 — CID 89292199
CID 89292199 (PubChem CID 89292199) has the molecular formula C9H8BN3O6 and a molecular weight of 264.99 g/mol.
| Compound Name | CID 89292199 |
|---|---|
| PubChem CID | 89292199 |
| Molecular Formula | C9H8BN3O6 |
| Molecular Weight | 264.99 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | — |
| SMILES | [B]c1c(C(=O)NCCO)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8BN3O6/c10-8-6(9(15)11-1-2-14)3-5(12(16)17)4-7(8)13(18)19/h3-4,14H,1-2H2,(H,11,15) |
| InChIKey | FGRKBEUSWDHYST-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.99 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|