C13H16N4O6 — CID 91055481
N-(6-amino-6-oxohexyl)-2,5-dinitrobenzamide (PubChem CID 91055481) has the molecular formula C13H16N4O6 and a molecular weight of 324.29 g/mol. Its IUPAC name is N-(6-amino-6-oxohexyl)-2,5-dinitrobenzamide.
| Compound Name | N-(6-amino-6-oxohexyl)-2,5-dinitrobenzamide |
|---|---|
| PubChem CID | 91055481 |
| Molecular Formula | C13H16N4O6 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-(6-amino-6-oxohexyl)-2,5-dinitrobenzamide |
| SMILES | NC(=O)CCCCCNC(=O)c1cc([N+](=O)[O-])ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N4O6/c14-12(18)4-2-1-3-7-15-13(19)10-8-9(16(20)21)5-6-11(10)17(22)23/h5-6,8H,1-4,7H2,(H2,14,18)(H,15,19) |
| InChIKey | IUPANCLENUCQJZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 158.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|