C12H14ClN3O4 — CID 106235410
N-(5-amino-5-oxopentyl)-4-chloro-3-nitrobenzamide (PubChem CID 106235410) has the molecular formula C12H14ClN3O4 and a molecular weight of 299.71 g/mol. Its IUPAC name is N-(5-amino-5-oxopentyl)-4-chloro-3-nitrobenzamide.
| Compound Name | N-(5-amino-5-oxopentyl)-4-chloro-3-nitrobenzamide |
|---|---|
| PubChem CID | 106235410 |
| Molecular Formula | C12H14ClN3O4 |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-(5-amino-5-oxopentyl)-4-chloro-3-nitrobenzamide |
| SMILES | NC(=O)CCCCNC(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14ClN3O4/c13-9-5-4-8(7-10(9)16(19)20)12(18)15-6-2-1-3-11(14)17/h4-5,7H,1-3,6H2,(H2,14,17)(H,15,18) |
| InChIKey | ODWSQAOHHYOIDF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|