C11H12ClN3O6 — CID 86048453
2-chloro-N-(4-hydroxybutyl)-3,5-dinitrobenzamide (PubChem CID 86048453) has the molecular formula C11H12ClN3O6 and a molecular weight of 317.69 g/mol. Its IUPAC name is 2-chloro-N-(4-hydroxybutyl)-3,5-dinitrobenzamide.
| Compound Name | 2-chloro-N-(4-hydroxybutyl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 86048453 |
| Molecular Formula | C11H12ClN3O6 |
| Molecular Weight | 317.69 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-chloro-N-(4-hydroxybutyl)-3,5-dinitrobenzamide |
| SMILES | O=C(NCCCCO)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C11H12ClN3O6/c12-10-8(11(17)13-3-1-2-4-16)5-7(14(18)19)6-9(10)15(20)21/h5-6,16H,1-4H2,(H,13,17) |
| InChIKey | SHBHMBYECSANEJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.69 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|